| Expire |
Country |
Pic |
Subject |
Popularity |
| never |  CN | | L-Cysteine hydrochloride anhydrous product Name: L-Cysteine hydrochloride anhydrous Synonyms: L-Cysteine hydrochloride; L-cysteine hcl cell culture tested; H- | 171 |
| never | CN | | Na-Fmoc-Ng-2,2,4,6,7-pentamethyl-dihydrobenzofuran-5-sulfonyl-L-arginine product Name: Na-Fmoc-Ng-2,2,4,6,7-pentamethyl-dihydrobenzofuran-5-sulfonyl-L-arginine | 171 |
| never | CN | | D(+)-Tryptophan product Name: D(+)-Tryptophan Synonyms: D-Tryptophan; (R)-2-Amino-3-(3-indolyl)propionic acid; H-D-Trp-OH; 3-(2,3-dihydro-1H-indol-3-yl)-D-ala | 171 |
| never | CN | | Vinylimidazole Name:Vinylimidazole Synonym:1-ethenyl-1h-imidazol;1-ethenyl-1H-Imidazole;1H-Imidazole, 1-ethenyl-;1-Vinyl-1H-imidazole;1-VINYLIMIDAZOLE;N-VINYL | 171 |
| never | CN | | N-Ethyl-N-3-((3-dimethylamino-1-oxo-2-propenyl)phenyl)acetamide CAS: 96605-66-2 MF: C15H20N2O2 MW: 260.33 EINECS: Usage An impurity and intermediate of Zale | 171 |
| never | CN | | N-(3-Chloropropyl)morpholine CAS: 7357-67-7 MF: C7H14ClNO MW: 163.65 EINECS: 461-510-0 mp NA storage temp. -20°C Freezer, Under Inert Atmosphere Chemica | 171 |
| never | CN | | beta-Methyl vinyl phosphate (MAP) Name: beta-Methyl vinyl phosphate (MAP) Synonym: p-nitrobenzyl (1r,5r,6s)-6-[(1r)-1-hydroxyethyl]-2-;P-NITROBENZYL (1R,5R,6S) | 171 |
| never | CN | | DL-Tryptophan CAS: 54-12-6 MF: C11H12N2O2 MW: 204.23 EINECS: 200-194-9 mp 289-290 °C (dec.)(lit.) storage temp. Store at RT. Water Solubility 10 g/L (20 | 171 |
| never | CN | | D-Plenylglycinol Name:D-Plenylglycinol Synonym:Benzeneethanol, beta-amino-, (R)-;(R)-b-Aminophenethyl alcohol;(R)-(-)-ALPHA-PHENYLGLYCINOL;(R)-(-)-2-AMINO-2-PH | 171 |
| never | CN | | 9-(4-Acetoxy-3-acetoxymethylbutyl)-2-amino-6-chloropurine Name:9-(4-Acetoxy-3-acetoxymethylbutyl)-2-amino-6-chloropurine Synonym:9-(4-ACETOXY-3-ACETOXYMETHYLB | 171 |
log in
